About 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate
1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate (PubChem CID 139068864) has the molecular formula C14H12N2O4
and a molecular weight of 272.26 g/mol. Its IUPAC name is 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate.
Molecular Properties
| Compound Name | 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate |
| PubChem CID | 139068864 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate |
| SMILES | O=C(O)c1cc([O-])cc(O)c1.c1ccc2[nH+]c[nH]c2c1 |
| InChI | InChI=1S/C7H6N2.C7H6O4/c1-2-4-7-6(3-1)8-5-9-7;8-5-1-4(7(10)11)2-6(9)3-5/h1-5H,(H,8,9);1-3,8-9H,(H,10,11) |
| InChIKey | BTGXHBMUQJCZAM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate?
The IUPAC name of 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate (CID 139068864) is 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate.
What is the SMILES notation for 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate?
The canonical SMILES for 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate is O=C(O)c1cc([O-])cc(O)c1.c1ccc2[nH+]c[nH]c2c1.
What is the InChIKey of 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate?
The InChIKey is BTGXHBMUQJCZAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C7H6O4/c1-2-4-7-6(3-1)8-5-9-7;8-5-1-4(7(10)11)2-6(9)3-5/h1-5H,(H,8,9);1-3,8-9H,(H,10,11).
What are the key properties of 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate?
1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate has a molecular weight of 272.26 g/mol, XLogP of 1.15, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-3-ium;3-carboxy-5-hydroxyphenolate is sourced from PubChem (CID 139068864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).