About (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate
(2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate (PubChem CID 139068958) has the molecular formula C23H18F3NO5S
and a molecular weight of 477.46 g/mol. Its IUPAC name is (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate |
| PubChem CID | 139068958 |
| Molecular Formula | C23H18F3NO5S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate |
| SMILES | Cc1ccccc1OC(=O)c1c2ccccc2[n+](C)c2ccccc12.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C22H18NO2.CHF3O3S/c1-15-9-3-8-14-20(15)25-22(24)21-16-10-4-6-12-18(16)23(2)19-13-7-5-11-17(19)21;2-1(3,4)8(5,6)7/h3-14H,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | GRALSLGEUZUQNA-UHFFFAOYSA-M |
| XLogP | 4.40 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate?
The IUPAC name of (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate (CID 139068958) is (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate.
What is the SMILES notation for (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate?
The canonical SMILES for (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate is Cc1ccccc1OC(=O)c1c2ccccc2[n+](C)c2ccccc12.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate?
The InChIKey is GRALSLGEUZUQNA-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H18NO2.CHF3O3S/c1-15-9-3-8-14-20(15)25-22(24)21-16-10-4-6-12-18(16)23(2)19-13-7-5-11-17(19)21;2-1(3,4)8(5,6)7/h3-14H,1-2H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate?
(2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate has a molecular weight of 477.46 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl) 10-methylacridin-10-ium-9-carboxylate;trifluoromethanesulfonate is sourced from PubChem (CID 139068958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).