About 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine
4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine (PubChem CID 139069111) has the molecular formula C26H20N2O5
and a molecular weight of 440.46 g/mol. Its IUPAC name is 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine.
Molecular Properties
| Compound Name | 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| PubChem CID | 139069111 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| SMILES | C(=C/c1ccncc1)\c1ccncc1.O=C(O)c1ccc(Oc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C14H10O5.C12H10N2/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18;1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h1-8H,(H,15,16)(H,17,18);1-10H/b;2-1+ |
| InChIKey | UZIWZPAEHASJOM-WLHGVMLRSA-N |
| XLogP | 5.52 |
| TPSA | 109.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The IUPAC name of 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine (CID 139069111) is 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine.
What is the SMILES notation for 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The canonical SMILES for 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine is C(=C/c1ccncc1)\c1ccncc1.O=C(O)c1ccc(Oc2ccc(C(=O)O)cc2)cc1.
What is the InChIKey of 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The InChIKey is UZIWZPAEHASJOM-WLHGVMLRSA-N. The full InChI is InChI=1S/C14H10O5.C12H10N2/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18;1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h1-8H,(H,15,16)(H,17,18);1-10H/b;2-1+.
What are the key properties of 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine?
4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine has a molecular weight of 440.46 g/mol, XLogP of 5.52, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-carboxyphenoxy)benzoic acid;4-[(E)-2-pyridin-4-ylethenyl]pyridine is sourced from PubChem (CID 139069111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).