C23H19N3O3 — CID 139069265
2-[3-[(3-methylphenoxy)methyl]-5-phenyl-1,2,4-triazol-4-yl]benzoic acid (PubChem CID 139069265) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[3-[(3-methylphenoxy)methyl]-5-phenyl-1,2,4-triazol-4-yl]benzoic acid.
| Compound Name | 2-[3-[(3-methylphenoxy)methyl]-5-phenyl-1,2,4-triazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 139069265 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[3-[(3-methylphenoxy)methyl]-5-phenyl-1,2,4-triazol-4-yl]benzoic acid |
| SMILES | Cc1cccc(OCc2nnc(-c3ccccc3)n2-c2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C23H19N3O3/c1-16-8-7-11-18(14-16)29-15-21-24-25-22(17-9-3-2-4-10-17)26(21)20-13-6-5-12-19(20)23(27)28/h2-14H,15H2,1H3,(H,27,28) |
| InChIKey | RAEFLORPQKMOAB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |