About zinc;1,10-phenanthroline;dibenzoate
zinc;1,10-phenanthroline;dibenzoate (PubChem CID 139069326) has the molecular formula C26H18N2O4Zn
and a molecular weight of 487.83 g/mol. Its IUPAC name is zinc;1,10-phenanthroline;dibenzoate.
Molecular Properties
| Compound Name | zinc;1,10-phenanthroline;dibenzoate |
| PubChem CID | 139069326 |
| Molecular Formula | C26H18N2O4Zn |
| Molecular Weight | 487.83 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | zinc;1,10-phenanthroline;dibenzoate |
| SMILES | O=C([O-])c1ccccc1.O=C([O-])c1ccccc1.[Zn+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.2C7H6O2.Zn/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2*8-7(9)6-4-2-1-3-5-6;/h1-8H;2*1-5H,(H,8,9);/q;;;+2/p-2 |
| InChIKey | XNHQUQAPFZEORZ-UHFFFAOYSA-L |
| XLogP | 2.88 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.83 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze zinc;1,10-phenanthroline;dibenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;1,10-phenanthroline;dibenzoate?
The IUPAC name of zinc;1,10-phenanthroline;dibenzoate (CID 139069326) is zinc;1,10-phenanthroline;dibenzoate.
What is the SMILES notation for zinc;1,10-phenanthroline;dibenzoate?
The canonical SMILES for zinc;1,10-phenanthroline;dibenzoate is O=C([O-])c1ccccc1.O=C([O-])c1ccccc1.[Zn+2].c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of zinc;1,10-phenanthroline;dibenzoate?
The InChIKey is XNHQUQAPFZEORZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H8N2.2C7H6O2.Zn/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2*8-7(9)6-4-2-1-3-5-6;/h1-8H;2*1-5H,(H,8,9);/q;;;+2/p-2.
What are the key properties of zinc;1,10-phenanthroline;dibenzoate?
zinc;1,10-phenanthroline;dibenzoate has a molecular weight of 487.83 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;1,10-phenanthroline;dibenzoate is sourced from PubChem (CID 139069326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).