C36H38N2O2Se2 — CID 139069348
(4S,6R)-4-methyl-2-(4-methylphenyl)-6-phenyl-5,6-dihydro-1,3-selenazin-4-ol (PubChem CID 139069348) has the molecular formula C36H38N2O2Se2 and a molecular weight of 688.63 g/mol. Its IUPAC name is (4S,6R)-4-methyl-2-(4-methylphenyl)-6-phenyl-5,6-dihydro-1,3-selenazin-4-ol.
| Compound Name | (4S,6R)-4-methyl-2-(4-methylphenyl)-6-phenyl-5,6-dihydro-1,3-selenazin-4-ol |
|---|---|
| PubChem CID | 139069348 |
| Molecular Formula | C36H38N2O2Se2 |
| Molecular Weight | 688.63 g/mol |
| Exact Mass | 690.13 |
| IUPAC Name | (4S,6R)-4-methyl-2-(4-methylphenyl)-6-phenyl-5,6-dihydro-1,3-selenazin-4-ol |
| SMILES | Cc1ccc(C2=N[C@@](C)(O)C[C@H](c3ccccc3)[Se]2)cc1.Cc1ccc(C2=N[C@@](C)(O)C[C@H](c3ccccc3)[Se]2)cc1 |
| InChI | InChI=1S/2C18H19NOSe/c2*1-13-8-10-15(11-9-13)17-19-18(2,20)12-16(21-17)14-6-4-3-5-7-14/h2*3-11,16,20H,12H2,1-2H3/t2*16-,18+/m11/s1 |
| InChIKey | IWIWJWHCKJPKGZ-RQSISSSHSA-N |
| XLogP | 6.60 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.63 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|