C14H20N2O5 — CID 139069446
N-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]acetamide;hydrate (PubChem CID 139069446) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is N-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]acetamide;hydrate.
| Compound Name | N-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]acetamide;hydrate |
|---|---|
| PubChem CID | 139069446 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]acetamide;hydrate |
| SMILES | CC(=O)Nc1ccc(OCC(=O)N2CCOCC2)cc1.O |
| InChI | InChI=1S/C14H18N2O4.H2O/c1-11(17)15-12-2-4-13(5-3-12)20-10-14(18)16-6-8-19-9-7-16;/h2-5H,6-10H2,1H3,(H,15,17);1H2 |
| InChIKey | WGHFTQRCSGQMLA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |