About 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate
3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate (PubChem CID 139069450) has the molecular formula C12H14ClN5O2S
and a molecular weight of 327.80 g/mol. Its IUPAC name is 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate.
Molecular Properties
| Compound Name | 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate |
| PubChem CID | 139069450 |
| Molecular Formula | C12H14ClN5O2S |
| Molecular Weight | 327.80 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate |
| SMILES | N#CCCn1nc(COc2ccc(Cl)cc2)n(N)c1=S.O |
| InChI | InChI=1S/C12H12ClN5OS.H2O/c13-9-2-4-10(5-3-9)19-8-11-16-17(7-1-6-14)12(20)18(11)15;/h2-5H,1,7-8,15H2;1H2 |
| InChIKey | IWAYEHQZFFYBPJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.80 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate?
The IUPAC name of 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate (CID 139069450) is 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate.
What is the SMILES notation for 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate?
The canonical SMILES for 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate is N#CCCn1nc(COc2ccc(Cl)cc2)n(N)c1=S.O.
What is the InChIKey of 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate?
The InChIKey is IWAYEHQZFFYBPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN5OS.H2O/c13-9-2-4-10(5-3-9)19-8-11-16-17(7-1-6-14)12(20)18(11)15;/h2-5H,1,7-8,15H2;1H2.
What are the key properties of 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate?
3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate has a molecular weight of 327.80 g/mol, XLogP of 1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-amino-3-[(4-chlorophenoxy)methyl]-5-sulfanylidene-1,2,4-triazol-1-yl]propanenitrile;hydrate is sourced from PubChem (CID 139069450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).