C28H34O3 — CID 139069514
methyl (1R,4aS,10aR)-6-benzoyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate (PubChem CID 139069514) has the molecular formula C28H34O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is methyl (1R,4aS,10aR)-6-benzoyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,10aR)-6-benzoyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 139069514 |
| Molecular Formula | C28H34O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | methyl (1R,4aS,10aR)-6-benzoyl-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)c3cc(C(=O)c4ccccc4)c(C(C)C)cc3CC[C@@H]12 |
| InChI | InChI=1S/C28H34O3/c1-18(2)21-16-20-12-13-24-27(3,14-9-15-28(24,4)26(30)31-5)23(20)17-22(21)25(29)19-10-7-6-8-11-19/h6-8,10-11,16-18,24H,9,12-15H2,1-5H3/t24-,27-,28-/m1/s1 |
| InChIKey | PRCDYNICQYSUBI-RYRVMRHHSA-N |
| XLogP | 6.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |