About 7-amino-1H-quinazoline-2,4-dithione
7-amino-1H-quinazoline-2,4-dithione (PubChem CID 139069553) has the molecular formula C8H7N3S2
and a molecular weight of 209.30 g/mol. Its IUPAC name is 7-amino-1H-quinazoline-2,4-dithione.
Molecular Properties
| Compound Name | 7-amino-1H-quinazoline-2,4-dithione |
| PubChem CID | 139069553 |
| Molecular Formula | C8H7N3S2 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 7-amino-1H-quinazoline-2,4-dithione |
| SMILES | Nc1ccc2c(=S)[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C8H7N3S2/c9-4-1-2-5-6(3-4)10-8(13)11-7(5)12/h1-3H,9H2,(H2,10,11,12,13) |
| InChIKey | QGTHGLPDLRPVHJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-1H-quinazoline-2,4-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-1H-quinazoline-2,4-dithione?
The IUPAC name of 7-amino-1H-quinazoline-2,4-dithione (CID 139069553) is 7-amino-1H-quinazoline-2,4-dithione.
What is the SMILES notation for 7-amino-1H-quinazoline-2,4-dithione?
The canonical SMILES for 7-amino-1H-quinazoline-2,4-dithione is Nc1ccc2c(=S)[nH]c(=S)[nH]c2c1.
What is the InChIKey of 7-amino-1H-quinazoline-2,4-dithione?
The InChIKey is QGTHGLPDLRPVHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3S2/c9-4-1-2-5-6(3-4)10-8(13)11-7(5)12/h1-3H,9H2,(H2,10,11,12,13).
What are the key properties of 7-amino-1H-quinazoline-2,4-dithione?
7-amino-1H-quinazoline-2,4-dithione has a molecular weight of 209.30 g/mol, XLogP of 2.54, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-1H-quinazoline-2,4-dithione is sourced from PubChem (CID 139069553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).