C15H20O4 — CID 139069674
(2S)-2-[(1R,3R,4S,7S,8S)-3,8-dimethyl-2,5-dioxo-1-tricyclo[5.3.0.04,8]decanyl]propanoic acid (PubChem CID 139069674) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2S)-2-[(1R,3R,4S,7S,8S)-3,8-dimethyl-2,5-dioxo-1-tricyclo[5.3.0.04,8]decanyl]propanoic acid.
| Compound Name | (2S)-2-[(1R,3R,4S,7S,8S)-3,8-dimethyl-2,5-dioxo-1-tricyclo[5.3.0.04,8]decanyl]propanoic acid |
|---|---|
| PubChem CID | 139069674 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (2S)-2-[(1R,3R,4S,7S,8S)-3,8-dimethyl-2,5-dioxo-1-tricyclo[5.3.0.04,8]decanyl]propanoic acid |
| SMILES | C[C@H](C(=O)O)[C@@]12CC[C@]3(C)[C@@H](C(=O)C[C@@H]31)[C@@H](C)C2=O |
| InChI | InChI=1S/C15H20O4/c1-7-11-9(16)6-10-14(11,3)4-5-15(10,12(7)17)8(2)13(18)19/h7-8,10-11H,4-6H2,1-3H3,(H,18,19)/t7-,8-,10+,11-,14+,15+/m1/s1 |
| InChIKey | FULQCULUKNCHLA-LOMPZCEWSA-N |
| XLogP | 1.92 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |