C37H26F12O9S4 — CID 139069760
bis(4-[2-(5-carboxy-2-methylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carboxylic acid);propan-2-one (PubChem CID 139069760) has the molecular formula C37H26F12O9S4 and a molecular weight of 970.85 g/mol. Its IUPAC name is bis(4-[2-(5-carboxy-2-methylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carboxylic acid);propan-2-one.
| Compound Name | bis(4-[2-(5-carboxy-2-methylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carboxylic acid);propan-2-one |
|---|---|
| PubChem CID | 139069760 |
| Molecular Formula | C37H26F12O9S4 |
| Molecular Weight | 970.85 g/mol |
| Exact Mass | 970.03 |
| IUPAC Name | bis(4-[2-(5-carboxy-2-methylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carboxylic acid);propan-2-one |
| SMILES | CC(C)=O.Cc1sc(C(=O)O)cc1C1=C(c2cc(C(=O)O)sc2C)C(F)(F)C(F)(F)C1(F)F.Cc1sc(C(=O)O)cc1C1=C(c2cc(C(=O)O)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/2C17H10F6O4S2.C3H6O/c2*1-5-7(3-9(28-5)13(24)25)11-12(8-4-10(14(26)27)29-6(8)2)16(20,21)17(22,23)15(11,18)19;1-3(2)4/h2*3-4H,1-2H3,(H,24,25)(H,26,27);1-2H3 |
| InChIKey | RWKBCAZEPYRBKK-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.85 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|