C28H24CuN6O4 — CID 139069835
copper bis((NE,1Z)-2-hydroxy-N-(1-pyridin-2-ylethylidene)benzenecarbohydrazonate) (PubChem CID 139069835) has the molecular formula C28H24CuN6O4 and a molecular weight of 572.08 g/mol. Its IUPAC name is copper bis((NE,1Z)-2-hydroxy-N-(1-pyridin-2-ylethylidene)benzenecarbohydrazonate).
| Compound Name | copper bis((NE,1Z)-2-hydroxy-N-(1-pyridin-2-ylethylidene)benzenecarbohydrazonate) |
|---|---|
| PubChem CID | 139069835 |
| Molecular Formula | C28H24CuN6O4 |
| Molecular Weight | 572.08 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | copper bis((NE,1Z)-2-hydroxy-N-(1-pyridin-2-ylethylidene)benzenecarbohydrazonate) |
| SMILES | C/C(=N\N=C(/[O-])c1ccccc1O)c1ccccn1.C/C(=N\N=C(/[O-])c1ccccc1O)c1ccccn1.[Cu+2] |
| InChI | InChI=1S/2C14H13N3O2.Cu/c2*1-10(12-7-4-5-9-15-12)16-17-14(19)11-6-2-3-8-13(11)18;/h2*2-9,18H,1H3,(H,17,19);/q;;+2/p-2/b2*16-10+; |
| InChIKey | STIQYFWPKUNHNK-JEFRERBXSA-L |
| XLogP | 2.63 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.08 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|