C32H40N2O3Si3 — CID 139069872
2-N,2-N'-ditert-butyl-4,4,6,6-tetraphenyl-1,3,5,2,4,6-trioxatrisilinane-2,2-diamine (PubChem CID 139069872) has the molecular formula C32H40N2O3Si3 and a molecular weight of 584.94 g/mol. Its IUPAC name is 2-N,2-N'-ditert-butyl-4,4,6,6-tetraphenyl-1,3,5,2,4,6-trioxatrisilinane-2,2-diamine.
| Compound Name | 2-N,2-N'-ditert-butyl-4,4,6,6-tetraphenyl-1,3,5,2,4,6-trioxatrisilinane-2,2-diamine |
|---|---|
| PubChem CID | 139069872 |
| Molecular Formula | C32H40N2O3Si3 |
| Molecular Weight | 584.94 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | 2-N,2-N'-ditert-butyl-4,4,6,6-tetraphenyl-1,3,5,2,4,6-trioxatrisilinane-2,2-diamine |
| SMILES | CC(C)(C)N[Si]1(NC(C)(C)C)O[Si](c2ccccc2)(c2ccccc2)O[Si](c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C32H40N2O3Si3/c1-31(2,3)33-40(34-32(4,5)6)36-38(27-19-11-7-12-20-27,28-21-13-8-14-22-28)35-39(37-40,29-23-15-9-16-24-29)30-25-17-10-18-26-30/h7-26,33-34H,1-6H3 |
| InChIKey | JTWSRNBGSPEPTK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.94 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|