C27H27N3O2S — CID 139069895
ethyl (2R,4S)-6-methyl-2,4-diphenyl-3-(phenylcarbamothioyl)-2,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 139069895) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is ethyl (2R,4S)-6-methyl-2,4-diphenyl-3-(phenylcarbamothioyl)-2,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (2R,4S)-6-methyl-2,4-diphenyl-3-(phenylcarbamothioyl)-2,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 139069895 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | ethyl (2R,4S)-6-methyl-2,4-diphenyl-3-(phenylcarbamothioyl)-2,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N[C@@H](c2ccccc2)N(C(=S)Nc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H27N3O2S/c1-3-32-26(31)23-19(2)28-25(21-15-9-5-10-16-21)30(24(23)20-13-7-4-8-14-20)27(33)29-22-17-11-6-12-18-22/h4-18,24-25,28H,3H2,1-2H3,(H,29,33)/t24-,25+/m0/s1 |
| InChIKey | IGLOIBFZNMAXCA-LOSJGSFVSA-N |
| XLogP | 5.57 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|