C29H27NO5 — CID 139069918
(E)-1-[(1R,2R,4R,7S,9S,12R)-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecan-8-yl]-3-phenylprop-2-en-1-one (PubChem CID 139069918) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is (E)-1-[(1R,2R,4R,7S,9S,12R)-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecan-8-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(1R,2R,4R,7S,9S,12R)-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecan-8-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 139069918 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (E)-1-[(1R,2R,4R,7S,9S,12R)-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecan-8-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1[C@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]2O[C@H](c3ccccc3)OC[C@@H]21 |
| InChI | InChI=1S/C29H27NO5/c31-25(17-16-20-10-4-1-5-11-20)30-23-18-32-28(21-12-6-2-7-13-21)34-26(23)27-24(30)19-33-29(35-27)22-14-8-3-9-15-22/h1-17,23-24,26-29H,18-19H2/b17-16+/t23-,24-,26+,27+,28+,29+/m0/s1 |
| InChIKey | IHXFLCSAZKMRIU-VXULSSGOSA-N |
| XLogP | 4.51 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|