About 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one
3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one (PubChem CID 139070255) has the molecular formula C24H17N2O2S+
and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one.
Molecular Properties
| Compound Name | 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one |
| PubChem CID | 139070255 |
| Molecular Formula | C24H17N2O2S+ |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1csc(Nc2ccccc2)[n+]1-c1ccccc1 |
| InChI | InChI=1S/C24H16N2O2S/c27-23-20(15-17-9-7-8-14-22(17)28-23)21-16-29-24(25-18-10-3-1-4-11-18)26(21)19-12-5-2-6-13-19/h1-16H/p+1 |
| InChIKey | IEYGHRJWVXISQT-UHFFFAOYSA-O |
| XLogP | 5.54 |
| TPSA | 46.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one?
The IUPAC name of 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one (CID 139070255) is 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one.
What is the SMILES notation for 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one?
The canonical SMILES for 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one is O=c1oc2ccccc2cc1-c1csc(Nc2ccccc2)[n+]1-c1ccccc1.
What is the InChIKey of 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one?
The InChIKey is IEYGHRJWVXISQT-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H16N2O2S/c27-23-20(15-17-9-7-8-14-22(17)28-23)21-16-29-24(25-18-10-3-1-4-11-18)26(21)19-12-5-2-6-13-19/h1-16H/p+1.
What are the key properties of 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one?
3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one has a molecular weight of 397.48 g/mol, XLogP of 5.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-anilino-3-phenyl-1,3-thiazol-3-ium-4-yl)chromen-2-one is sourced from PubChem (CID 139070255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).