About iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine
iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine (PubChem CID 139070385) has the molecular formula C12H12FeN4
and a molecular weight of 268.10 g/mol. Its IUPAC name is iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine.
Molecular Properties
| Compound Name | iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine |
| PubChem CID | 139070385 |
| Molecular Formula | C12H12FeN4 |
| Molecular Weight | 268.10 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine |
| SMILES | C(=N/CC/N=C/c1ccc[n-]1)\c1ccc[n-]1.[Fe+2] |
| InChI | InChI=1S/C12H12N4.Fe/c1-3-11(15-5-1)9-13-7-8-14-10-12-4-2-6-16-12;/h1-6,9-10H,7-8H2;/q-2;+2/b13-9+,14-10+; |
| InChIKey | CYNCUBNNHXYCGK-ALGRVRKVSA-N |
| XLogP | 1.14 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.10 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine?
The IUPAC name of iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine (CID 139070385) is iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine.
What is the SMILES notation for iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine?
The canonical SMILES for iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine is C(=N/CC/N=C/c1ccc[n-]1)\c1ccc[n-]1.[Fe+2].
What is the InChIKey of iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine?
The InChIKey is CYNCUBNNHXYCGK-ALGRVRKVSA-N. The full InChI is InChI=1S/C12H12N4.Fe/c1-3-11(15-5-1)9-13-7-8-14-10-12-4-2-6-16-12;/h1-6,9-10H,7-8H2;/q-2;+2/b13-9+,14-10+;.
What are the key properties of iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine?
iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine has a molecular weight of 268.10 g/mol, XLogP of 1.14, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);1-pyrrol-1-id-2-yl-N-[2-(pyrrol-1-id-2-ylmethylideneamino)ethyl]methanimine is sourced from PubChem (CID 139070385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).