About [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate
[amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate (PubChem CID 139071002) has the molecular formula C22H20N4O4S
and a molecular weight of 436.49 g/mol. Its IUPAC name is [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate.
Molecular Properties
| Compound Name | [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate |
| PubChem CID | 139071002 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate |
| SMILES | N/C(Nc1ccccc1)=[NH+]\c1ccccc1.O=S(=O)([O-])c1ccc(O)c2ncccc12 |
| InChI | InChI=1S/C13H13N3.C9H7NO4S/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;11-7-3-4-8(15(12,13)14)6-2-1-5-10-9(6)7/h1-10H,(H3,14,15,16);1-5,11H,(H,12,13,14) |
| InChIKey | OCHYUTAYDQEFMN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate?
The IUPAC name of [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate (CID 139071002) is [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate.
What is the SMILES notation for [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate?
The canonical SMILES for [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate is N/C(Nc1ccccc1)=[NH+]\c1ccccc1.O=S(=O)([O-])c1ccc(O)c2ncccc12.
What is the InChIKey of [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate?
The InChIKey is OCHYUTAYDQEFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3.C9H7NO4S/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;11-7-3-4-8(15(12,13)14)6-2-1-5-10-9(6)7/h1-10H,(H3,14,15,16);1-5,11H,(H,12,13,14).
What are the key properties of [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate?
[amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate has a molecular weight of 436.49 g/mol, XLogP of 1.67, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [amino(anilino)methylidene]-phenylazanium;8-hydroxyquinoline-5-sulfonate is sourced from PubChem (CID 139071002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).