C30H36N6O6 — CID 139071009
diethyl 3,9-bis[(4-methylphenyl)methyl]-6,14-dioxo-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-12,13-dicarboxylate (PubChem CID 139071009) has the molecular formula C30H36N6O6 and a molecular weight of 576.65 g/mol. Its IUPAC name is diethyl 3,9-bis[(4-methylphenyl)methyl]-6,14-dioxo-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-12,13-dicarboxylate.
| Compound Name | diethyl 3,9-bis[(4-methylphenyl)methyl]-6,14-dioxo-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-12,13-dicarboxylate |
|---|---|
| PubChem CID | 139071009 |
| Molecular Formula | C30H36N6O6 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | diethyl 3,9-bis[(4-methylphenyl)methyl]-6,14-dioxo-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecane-12,13-dicarboxylate |
| SMILES | CCOC(=O)C12N3CN(Cc4ccc(C)cc4)CN1C(=O)N1CN(Cc4ccc(C)cc4)CN(C3=O)C12C(=O)OCC |
| InChI | InChI=1S/C30H36N6O6/c1-5-41-25(37)29-30(26(38)42-6-2)35-19-32(16-24-13-9-22(4)10-14-24)20-36(30)28(40)34(29)18-31(17-33(29)27(35)39)15-23-11-7-21(3)8-12-23/h7-14H,5-6,15-20H2,1-4H3 |
| InChIKey | OTZGUGKKLIDLLL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 106.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |