About bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate
bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate (PubChem CID 139071088) has the molecular formula C14H14Br4O5
and a molecular weight of 581.88 g/mol. Its IUPAC name is bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate.
Molecular Properties
| Compound Name | bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate |
| PubChem CID | 139071088 |
| Molecular Formula | C14H14Br4O5 |
| Molecular Weight | 581.88 g/mol |
| Exact Mass | 577.76 |
| IUPAC Name | bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate |
| SMILES | O.OCc1cc(Br)cc(Br)c1O.OCc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/2C7H6Br2O2.H2O/c2*8-5-1-4(3-10)7(11)6(9)2-5;/h2*1-2,10-11H,3H2;1H2 |
| InChIKey | RFIZMJPPFCUDJF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 581.88 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate?
The IUPAC name of bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate (CID 139071088) is bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate.
What is the SMILES notation for bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate?
The canonical SMILES for bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate is O.OCc1cc(Br)cc(Br)c1O.OCc1cc(Br)cc(Br)c1O.
What is the InChIKey of bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate?
The InChIKey is RFIZMJPPFCUDJF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6Br2O2.H2O/c2*8-5-1-4(3-10)7(11)6(9)2-5;/h2*1-2,10-11H,3H2;1H2.
What are the key properties of bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate?
bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate has a molecular weight of 581.88 g/mol, XLogP of 3.99, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,4-dibromo-6-(hydroxymethyl)phenol);hydrate is sourced from PubChem (CID 139071088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).