About 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine
1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine (PubChem CID 139071345) has the molecular formula C15H14FIN2O2S
and a molecular weight of 432.26 g/mol. Its IUPAC name is 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine |
| PubChem CID | 139071345 |
| Molecular Formula | C15H14FIN2O2S |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cc(F)ccc1Sc1ccc(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14FIN2O2S/c1-18(2)9-10-7-11(16)3-5-14(10)22-15-6-4-12(17)8-13(15)19(20)21/h3-8H,9H2,1-2H3 |
| InChIKey | IEHFEJCNPHMNMO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine (CID 139071345) is 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine is CN(C)Cc1cc(F)ccc1Sc1ccc(I)cc1[N+](=O)[O-].
What is the InChIKey of 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine?
The InChIKey is IEHFEJCNPHMNMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14FIN2O2S/c1-18(2)9-10-7-11(16)3-5-14(10)22-15-6-4-12(17)8-13(15)19(20)21/h3-8H,9H2,1-2H3.
What are the key properties of 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine?
1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine has a molecular weight of 432.26 g/mol, XLogP of 4.55, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-fluoro-2-(4-iodo-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine is sourced from PubChem (CID 139071345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).