About 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate
1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate (PubChem CID 139071539) has the molecular formula C14H18N2O9S
and a molecular weight of 390.37 g/mol. Its IUPAC name is 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate.
Molecular Properties
| Compound Name | 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate |
| PubChem CID | 139071539 |
| Molecular Formula | C14H18N2O9S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate |
| SMILES | O.O.O.O=C(O)c1cc(S(=O)(=O)[O-])ccc1O.c1ccc2[nH+]c[nH]c2c1 |
| InChI | InChI=1S/C7H6N2.C7H6O6S.3H2O/c1-2-4-7-6(3-1)8-5-9-7;8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;;;/h1-5H,(H,8,9);1-3,8H,(H,9,10)(H,11,12,13);3*1H2 |
| InChIKey | XKXHGXWPZDZSTN-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 239.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate?
The IUPAC name of 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate (CID 139071539) is 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate.
What is the SMILES notation for 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate?
The canonical SMILES for 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate is O.O.O.O=C(O)c1cc(S(=O)(=O)[O-])ccc1O.c1ccc2[nH+]c[nH]c2c1.
What is the InChIKey of 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate?
The InChIKey is XKXHGXWPZDZSTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C7H6O6S.3H2O/c1-2-4-7-6(3-1)8-5-9-7;8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;;;/h1-5H,(H,8,9);1-3,8H,(H,9,10)(H,11,12,13);3*1H2.
What are the key properties of 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate?
1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate has a molecular weight of 390.37 g/mol, XLogP of -1.50, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazol-3-ium;3-carboxy-4-hydroxybenzenesulfonate;trihydrate is sourced from PubChem (CID 139071539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).