About 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one
1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one (PubChem CID 139071919) has the molecular formula C36H36O4S4
and a molecular weight of 660.95 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one |
| PubChem CID | 139071919 |
| Molecular Formula | C36H36O4S4 |
| Molecular Weight | 660.95 g/mol |
| Exact Mass | 660.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C(=C(SC)SC)c2ccccc2)cc1.COc1ccc(C(=O)C(=C(SC)SC)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H18O2S2/c2*1-20-15-11-9-14(10-12-15)17(19)16(18(21-2)22-3)13-7-5-4-6-8-13/h2*4-12H,1-3H3 |
| InChIKey | HDAZWTOAVRCRCE-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 660.95 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one?
The IUPAC name of 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one (CID 139071919) is 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one.
What is the SMILES notation for 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one?
The canonical SMILES for 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one is COc1ccc(C(=O)C(=C(SC)SC)c2ccccc2)cc1.COc1ccc(C(=O)C(=C(SC)SC)c2ccccc2)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one?
The InChIKey is HDAZWTOAVRCRCE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H18O2S2/c2*1-20-15-11-9-14(10-12-15)17(19)16(18(21-2)22-3)13-7-5-4-6-8-13/h2*4-12H,1-3H3.
What are the key properties of 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one?
1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one has a molecular weight of 660.95 g/mol, XLogP of 9.95, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-3,3-bis(methylsulfanyl)-2-phenylprop-2-en-1-one is sourced from PubChem (CID 139071919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).