C16H13Cl3N2O3S — CID 139072107
4,5,7-trichloro-6-(2,4-dimethyl-1,3-thiazol-5-yl)-2-(3-hydroxypropyl)isoindole-1,3-dione (PubChem CID 139072107) has the molecular formula C16H13Cl3N2O3S and a molecular weight of 419.72 g/mol. Its IUPAC name is 4,5,7-trichloro-6-(2,4-dimethyl-1,3-thiazol-5-yl)-2-(3-hydroxypropyl)isoindole-1,3-dione.
| Compound Name | 4,5,7-trichloro-6-(2,4-dimethyl-1,3-thiazol-5-yl)-2-(3-hydroxypropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 139072107 |
| Molecular Formula | C16H13Cl3N2O3S |
| Molecular Weight | 419.72 g/mol |
| Exact Mass | 417.97 |
| IUPAC Name | 4,5,7-trichloro-6-(2,4-dimethyl-1,3-thiazol-5-yl)-2-(3-hydroxypropyl)isoindole-1,3-dione |
| SMILES | Cc1nc(C)c(-c2c(Cl)c(Cl)c3c(c2Cl)C(=O)N(CCCO)C3=O)s1 |
| InChI | InChI=1S/C16H13Cl3N2O3S/c1-6-14(25-7(2)20-6)10-11(17)8-9(12(18)13(10)19)16(24)21(15(8)23)4-3-5-22/h22H,3-5H2,1-2H3 |
| InChIKey | QNTYDLDERQDEQM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.72 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|