C15H16O4 — CID 139072119
(4S,8S)-10-hydroxy-4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),9-triene-6,11-dione (PubChem CID 139072119) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (4S,8S)-10-hydroxy-4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),9-triene-6,11-dione.
| Compound Name | (4S,8S)-10-hydroxy-4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),9-triene-6,11-dione |
|---|---|
| PubChem CID | 139072119 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (4S,8S)-10-hydroxy-4,8,12-trimethyl-2-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),9-triene-6,11-dione |
| SMILES | CC1=C2OC[C@@H](C)C3=C2C(=C(O)C1=O)[C@@H](C)CC3=O |
| InChI | InChI=1S/C15H16O4/c1-6-4-9(16)10-7(2)5-19-15-8(3)13(17)14(18)11(6)12(10)15/h6-7,18H,4-5H2,1-3H3/t6-,7+/m0/s1 |
| InChIKey | AKDXIPQJXIUTOK-NKWVEPMBSA-N |
| XLogP | 2.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |