About (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium
(3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium (PubChem CID 139072182) has the molecular formula C15H15NO7
and a molecular weight of 321.28 g/mol. Its IUPAC name is (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium.
Molecular Properties
| Compound Name | (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium |
| PubChem CID | 139072182 |
| Molecular Formula | C15H15NO7 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium |
| SMILES | O=C([O-])C[C@](O)(CC(=O)O)C(=O)O.c1ccc2[nH+]cccc2c1 |
| InChI | InChI=1S/C9H7N.C6H8O7/c1-2-6-9-8(4-1)5-3-7-10-9;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-7H;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | FYLUVRVNKSCPRG-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 149.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium?
The IUPAC name of (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium (CID 139072182) is (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium.
What is the SMILES notation for (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium?
The canonical SMILES for (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium is O=C([O-])C[C@](O)(CC(=O)O)C(=O)O.c1ccc2[nH+]cccc2c1.
What is the InChIKey of (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium?
The InChIKey is FYLUVRVNKSCPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H8O7/c1-2-6-9-8(4-1)5-3-7-10-9;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-7H;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12).
What are the key properties of (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium?
(3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium has a molecular weight of 321.28 g/mol, XLogP of -0.93, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-carboxy-3,5-dihydroxy-5-oxopentanoate;quinolin-1-ium is sourced from PubChem (CID 139072182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).