About N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide
N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide (PubChem CID 139072416) has the molecular formula C14H8Cl2F3N5OS
and a molecular weight of 422.22 g/mol. Its IUPAC name is N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide.
Molecular Properties
| Compound Name | N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide |
| PubChem CID | 139072416 |
| Molecular Formula | C14H8Cl2F3N5OS |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 420.98 |
| IUPAC Name | N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide |
| SMILES | CC(=O)NC(=S)Nc1cc(C#N)nn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H8Cl2F3N5OS/c1-6(25)21-13(26)22-11-4-8(5-20)23-24(11)12-9(15)2-7(3-10(12)16)14(17,18)19/h2-4H,1H3,(H2,21,22,25,26) |
| InChIKey | FYYJLKJVXKMCJF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide?
The IUPAC name of N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide (CID 139072416) is N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide.
What is the SMILES notation for N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide?
The canonical SMILES for N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide is CC(=O)NC(=S)Nc1cc(C#N)nn1-c1c(Cl)cc(C(F)(F)F)cc1Cl.
What is the InChIKey of N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide?
The InChIKey is FYYJLKJVXKMCJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2F3N5OS/c1-6(25)21-13(26)22-11-4-8(5-20)23-24(11)12-9(15)2-7(3-10(12)16)14(17,18)19/h2-4H,1H3,(H2,21,22,25,26).
What are the key properties of N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide?
N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide has a molecular weight of 422.22 g/mol, XLogP of 3.90, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]carbamothioyl]acetamide is sourced from PubChem (CID 139072416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).