C15H15Cl2NO3S3 — CID 139072582
5-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,4,6-oxadithiocane (PubChem CID 139072582) has the molecular formula C15H15Cl2NO3S3 and a molecular weight of 424.40 g/mol. Its IUPAC name is 5-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,4,6-oxadithiocane.
| Compound Name | 5-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,4,6-oxadithiocane |
|---|---|
| PubChem CID | 139072582 |
| Molecular Formula | C15H15Cl2NO3S3 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 422.96 |
| IUPAC Name | 5-[3,3-dichloro-2-(4-methylphenyl)sulfanyl-1-nitroprop-2-enylidene]-1,4,6-oxadithiocane |
| SMILES | Cc1ccc(SC(=C(Cl)Cl)C(=C2SCCOCCS2)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H15Cl2NO3S3/c1-10-2-4-11(5-3-10)24-13(14(16)17)12(18(19)20)15-22-8-6-21-7-9-23-15/h2-5H,6-9H2,1H3 |
| InChIKey | BDPMBBLQCKVSJZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|