C12H16O3 — CID 139072688
2-[(2S,8aS)-6-oxo-2,3,4,7,8,8a-hexahydro-1H-naphthalen-2-yl]acetic acid (PubChem CID 139072688) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-[(2S,8aS)-6-oxo-2,3,4,7,8,8a-hexahydro-1H-naphthalen-2-yl]acetic acid.
| Compound Name | 2-[(2S,8aS)-6-oxo-2,3,4,7,8,8a-hexahydro-1H-naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 139072688 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-[(2S,8aS)-6-oxo-2,3,4,7,8,8a-hexahydro-1H-naphthalen-2-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1CCC2=CC(=O)CC[C@H]2C1 |
| InChI | InChI=1S/C12H16O3/c13-11-4-3-9-5-8(6-12(14)15)1-2-10(9)7-11/h7-9H,1-6H2,(H,14,15)/t8-,9-/m0/s1 |
| InChIKey | TYJIKMVTHGTDRU-IUCAKERBSA-N |
| XLogP | 2.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |