C54H48N10Ni2O4 — CID 139072730
bis(nickel(2+));(NZ,1Z)-2-oxido-N-[oxido-(2-oxidophenyl)methylidene]benzenecarbohydrazonate;octakis(pyridine) (PubChem CID 139072730) has the molecular formula C54H48N10Ni2O4 and a molecular weight of 1018.43 g/mol. Its IUPAC name is bis(nickel(2+));(NZ,1Z)-2-oxido-N-[oxido-(2-oxidophenyl)methylidene]benzenecarbohydrazonate;octakis(pyridine).
| Compound Name | bis(nickel(2+));(NZ,1Z)-2-oxido-N-[oxido-(2-oxidophenyl)methylidene]benzenecarbohydrazonate;octakis(pyridine) |
|---|---|
| PubChem CID | 139072730 |
| Molecular Formula | C54H48N10Ni2O4 |
| Molecular Weight | 1018.43 g/mol |
| Exact Mass | 1016.26 |
| IUPAC Name | bis(nickel(2+));(NZ,1Z)-2-oxido-N-[oxido-(2-oxidophenyl)methylidene]benzenecarbohydrazonate;octakis(pyridine) |
| SMILES | [Ni+2].[Ni+2].[O-]/C(=N\N=C(/[O-])c1ccccc1[O-])c1ccccc1[O-].c1ccncc1.c1ccncc1.c1ccncc1.c1ccncc1.c1ccncc1.c1ccncc1.c1ccncc1.c1ccncc1 |
| InChI | InChI=1S/C14H12N2O4.8C5H5N.2Ni/c17-11-7-3-1-5-9(11)13(19)15-16-14(20)10-6-2-4-8-12(10)18;8*1-2-4-6-5-3-1;;/h1-8,17-18H,(H,15,19)(H,16,20);8*1-5H;;/q;;;;;;;;;2*+2/p-4 |
| InChIKey | VZDLZHWQKGLNGV-UHFFFAOYSA-J |
| XLogP | 7.31 |
| TPSA | 220.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.43 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|