C40H36N8O8 — CID 139072823
12,13-diphenyl-3,9-dioxa-1,5,7,11-tetrazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione (PubChem CID 139072823) has the molecular formula C40H36N8O8 and a molecular weight of 756.78 g/mol. Its IUPAC name is 12,13-diphenyl-3,9-dioxa-1,5,7,11-tetrazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione.
| Compound Name | 12,13-diphenyl-3,9-dioxa-1,5,7,11-tetrazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
|---|---|
| PubChem CID | 139072823 |
| Molecular Formula | C40H36N8O8 |
| Molecular Weight | 756.78 g/mol |
| Exact Mass | 756.27 |
| IUPAC Name | 12,13-diphenyl-3,9-dioxa-1,5,7,11-tetrazatetracyclo[9.2.1.05,13.07,12]tetradecane-6,14-dione |
| SMILES | O=C1N2COCN3C(=O)N4COCN1C4(c1ccccc1)C23c1ccccc1.O=C1N2COCN3C(=O)N4COCN1C4(c1ccccc1)C23c1ccccc1 |
| InChI | InChI=1S/2C20H18N4O4/c2*25-17-21-11-27-12-22-18(26)24-14-28-13-23(17)20(24,16-9-5-2-6-10-16)19(21,22)15-7-3-1-4-8-15/h2*1-10H,11-14H2 |
| InChIKey | BGTJODZLZKSCFY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 131.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.78 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |