About 6-Methoxy-1'-methyl-4'-phenylchroman-3-spiro-3'-pyrrolidine-2'-spiro-3''(2''H)-indole-2'',4-dione
6-Methoxy-1'-methyl-4'-phenylchroman-3-spiro-3'-pyrrolidine-2'-spiro-3''(2''H)-indole-2'',4-dione (PubChem CID 139072896) has the molecular formula C27H24N2O4
and a molecular weight of 440.50 g/mol.
Molecular Properties
| Compound Name | 6-Methoxy-1'-methyl-4'-phenylchroman-3-spiro-3'-pyrrolidine-2'-spiro-3''(2''H)-indole-2'',4-dione |
| PubChem CID | 139072896 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)C(=O)[C@]1(CO2)[C@@H](c2ccccc2)CN(C)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C27H24N2O4/c1-29-15-21(17-8-4-3-5-9-17)26(27(29)20-10-6-7-11-22(20)28-25(27)31)16-33-23-13-12-18(32-2)14-19(23)24(26)30/h3-14,21H,15-16H2,1-2H3,(H,28,31)/t21-,26+,27+/m1/s1 |
| InChIKey | MNISFLJRSSWETI-AIGMYPEUSA-N |
| XLogP | 3.83 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-Methoxy-1'-methyl-4'-phenylchroman-3-spiro-3'-pyrrolidine-2'-spiro-3''(2''H)-indole-2'',4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-Methoxy-1'-methyl-4'-phenylchroman-3-spiro-3'-pyrrolidine-2'-spiro-3''(2''H)-indole-2'',4-dione?
The IUPAC name of 6-Methoxy-1'-methyl-4'-phenylchroman-3-spiro-3'-pyrrolidine-2'-spiro-3''(2''H)-indole-2'',4-dione (CID 139072896) is not available.
What is the SMILES notation for 6-Methoxy-1'-methyl-4'-phenylchroman-3-spiro-3'-pyrrolidine-2'-spiro-3''(2''H)-indole-2'',4-dione?
The canonical SMILES for 6-Methoxy-1'-methyl-4'-phenylchroman-3-spiro-3'-pyrrolidine-2'-spiro-3''(2''H)-indole-2'',4-dione is COc1ccc2c(c1)C(=O)[C@]1(CO2)[C@@H](c2ccccc2)CN(C)[C@@]12C(=O)Nc1ccccc12.
What is the InChIKey of 6-Methoxy-1'-methyl-4'-phenylchroman-3-spiro-3'-pyrrolidine-2'-spiro-3''(2''H)-indole-2'',4-dione?
The InChIKey is MNISFLJRSSWETI-AIGMYPEUSA-N. The full InChI is InChI=1S/C27H24N2O4/c1-29-15-21(17-8-4-3-5-9-17)26(27(29)20-10-6-7-11-22(20)28-25(27)31)16-33-23-13-12-18(32-2)14-19(23)24(26)30/h3-14,21H,15-16H2,1-2H3,(H,28,31)/t21-,26+,27+/m1/s1.
What are the key properties of 6-Methoxy-1'-methyl-4'-phenylchroman-3-spiro-3'-pyrrolidine-2'-spiro-3''(2''H)-indole-2'',4-dione?
6-Methoxy-1'-methyl-4'-phenylchroman-3-spiro-3'-pyrrolidine-2'-spiro-3''(2''H)-indole-2'',4-dione has a molecular weight of 440.50 g/mol, XLogP of 3.83, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-Methoxy-1'-methyl-4'-phenylchroman-3-spiro-3'-pyrrolidine-2'-spiro-3''(2''H)-indole-2'',4-dione is sourced from PubChem (CID 139072896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).