About ditert-butyl(methyl)phosphanium chloride
ditert-butyl(methyl)phosphanium chloride (PubChem CID 139073045) has the molecular formula C9H22ClP
and a molecular weight of 196.70 g/mol. Its IUPAC name is ditert-butyl(methyl)phosphanium chloride.
Molecular Properties
| Compound Name | ditert-butyl(methyl)phosphanium chloride |
| PubChem CID | 139073045 |
| Molecular Formula | C9H22ClP |
| Molecular Weight | 196.70 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | ditert-butyl(methyl)phosphanium chloride |
| SMILES | C[PH+](C(C)(C)C)C(C)(C)C.[Cl-] |
| InChI | InChI=1S/C9H21P.ClH/c1-8(2,3)10(7)9(4,5)6;/h1-7H3;1H |
| InChIKey | TXEBXRMKQNWXAG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.70 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl(methyl)phosphanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl(methyl)phosphanium chloride?
The IUPAC name of ditert-butyl(methyl)phosphanium chloride (CID 139073045) is ditert-butyl(methyl)phosphanium chloride.
What is the SMILES notation for ditert-butyl(methyl)phosphanium chloride?
The canonical SMILES for ditert-butyl(methyl)phosphanium chloride is C[PH+](C(C)(C)C)C(C)(C)C.[Cl-].
What is the InChIKey of ditert-butyl(methyl)phosphanium chloride?
The InChIKey is TXEBXRMKQNWXAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21P.ClH/c1-8(2,3)10(7)9(4,5)6;/h1-7H3;1H.
What are the key properties of ditert-butyl(methyl)phosphanium chloride?
ditert-butyl(methyl)phosphanium chloride has a molecular weight of 196.70 g/mol, XLogP of 0.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl(methyl)phosphanium chloride is sourced from PubChem (CID 139073045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).