C21H15FN4O3 — CID 139073161
[(2R)-3-(benzotriazol-1-yl)-1-(2-fluorophenyl)-1-oxopropan-2-yl] pyridine-3-carboxylate (PubChem CID 139073161) has the molecular formula C21H15FN4O3 and a molecular weight of 390.37 g/mol. Its IUPAC name is [(2R)-3-(benzotriazol-1-yl)-1-(2-fluorophenyl)-1-oxopropan-2-yl] pyridine-3-carboxylate.
| Compound Name | [(2R)-3-(benzotriazol-1-yl)-1-(2-fluorophenyl)-1-oxopropan-2-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139073161 |
| Molecular Formula | C21H15FN4O3 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [(2R)-3-(benzotriazol-1-yl)-1-(2-fluorophenyl)-1-oxopropan-2-yl] pyridine-3-carboxylate |
| SMILES | O=C(O[C@H](Cn1nnc2ccccc21)C(=O)c1ccccc1F)c1cccnc1 |
| InChI | InChI=1S/C21H15FN4O3/c22-16-8-2-1-7-15(16)20(27)19(29-21(28)14-6-5-11-23-12-14)13-26-18-10-4-3-9-17(18)24-25-26/h1-12,19H,13H2/t19-/m1/s1 |
| InChIKey | NSDUTPSAOXOWRP-LJQANCHMSA-N |
| XLogP | 3.07 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |