C15H17N5O2 — CID 139073317
(2E,4E)-hexa-2,4-dienoic acid;6-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 139073317) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2E,4E)-hexa-2,4-dienoic acid;6-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | (2E,4E)-hexa-2,4-dienoic acid;6-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139073317 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (2E,4E)-hexa-2,4-dienoic acid;6-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | C/C=C/C=C/C(=O)O.Nc1nc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H9N5.C6H8O2/c10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6;1-2-3-4-5-6(7)8/h1-5H,(H4,10,11,12,13,14);2-5H,1H3,(H,7,8)/b;3-2+,5-4+ |
| InChIKey | PMAVFJYIVURLRP-PLKIVWSFSA-N |
| XLogP | 1.91 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|