About bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+)
bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+) (PubChem CID 139073490) has the molecular formula C28H22N2O6Pb
and a molecular weight of 689.69 g/mol. Its IUPAC name is bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+).
Molecular Properties
| Compound Name | bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+) |
| PubChem CID | 139073490 |
| Molecular Formula | C28H22N2O6Pb |
| Molecular Weight | 689.69 g/mol |
| Exact Mass | 690.12 |
| IUPAC Name | bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+) |
| SMILES | Cc1ccc2ccc3ccc(C)nc3c2n1.O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].[Pb+2] |
| InChI | InChI=1S/C14H12N2.2C7H6O3.Pb/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;2*8-6-4-2-1-3-5(6)7(9)10;/h3-8H,1-2H3;2*1-4,8H,(H,9,10);/q;;;+2/p-2 |
| InChIKey | SNPCQGQTHSTYLO-UHFFFAOYSA-L |
| XLogP | 3.94 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 689.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+)?
The IUPAC name of bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+) (CID 139073490) is bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+).
What is the SMILES notation for bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+)?
The canonical SMILES for bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+) is Cc1ccc2ccc3ccc(C)nc3c2n1.O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].[Pb+2].
What is the InChIKey of bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+)?
The InChIKey is SNPCQGQTHSTYLO-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H12N2.2C7H6O3.Pb/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;2*8-6-4-2-1-3-5(6)7(9)10;/h3-8H,1-2H3;2*1-4,8H,(H,9,10);/q;;;+2/p-2.
What are the key properties of bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+)?
bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+) has a molecular weight of 689.69 g/mol, XLogP of 3.94, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-carboxyphenolate);2,9-dimethyl-1,10-phenanthroline;lead(2+) is sourced from PubChem (CID 139073490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).