About 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium
2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium (PubChem CID 139073498) has the molecular formula C15H10Cl2F3NO4
and a molecular weight of 396.15 g/mol. Its IUPAC name is 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium.
Molecular Properties
| Compound Name | 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium |
| PubChem CID | 139073498 |
| Molecular Formula | C15H10Cl2F3NO4 |
| Molecular Weight | 396.15 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium |
| SMILES | O=C([O-])c1cc(Cl)c(Cl)cc1C(=O)O.[NH3+]c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H4Cl2O4.C7H6F3N/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10;8-7(9,10)5-2-1-3-6(11)4-5/h1-2H,(H,11,12)(H,13,14);1-4H,11H2 |
| InChIKey | YTWKHOPZHJLICG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.15 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium?
The IUPAC name of 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium (CID 139073498) is 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium.
What is the SMILES notation for 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium?
The canonical SMILES for 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium is O=C([O-])c1cc(Cl)c(Cl)cc1C(=O)O.[NH3+]c1cccc(C(F)(F)F)c1.
What is the InChIKey of 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium?
The InChIKey is YTWKHOPZHJLICG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2O4.C7H6F3N/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10;8-7(9,10)5-2-1-3-6(11)4-5/h1-2H,(H,11,12)(H,13,14);1-4H,11H2.
What are the key properties of 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium?
2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium has a molecular weight of 396.15 g/mol, XLogP of 2.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxy-4,5-dichlorobenzoate;[3-(trifluoromethyl)phenyl]azanium is sourced from PubChem (CID 139073498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).