C6H8N6 — CID 139073666
N'-cyano-3,5-dimethyl-1,2,4-triazole-1-carboximidamide (PubChem CID 139073666) has the molecular formula C6H8N6 and a molecular weight of 164.17 g/mol. Its IUPAC name is N'-cyano-3,5-dimethyl-1,2,4-triazole-1-carboximidamide.
| Compound Name | N'-cyano-3,5-dimethyl-1,2,4-triazole-1-carboximidamide |
|---|---|
| PubChem CID | 139073666 |
| Molecular Formula | C6H8N6 |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | N'-cyano-3,5-dimethyl-1,2,4-triazole-1-carboximidamide |
| SMILES | Cc1nc(C)n(/C(N)=N/C#N)n1 |
| InChI | InChI=1S/C6H8N6/c1-4-10-5(2)12(11-4)6(8)9-3-7/h1-2H3,(H2,8,9) |
| InChIKey | MAMOOTWPDJBCHG-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 92.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|