C24H19F6NS — CID 139073894
2-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-N,N-dimethylaniline (PubChem CID 139073894) has the molecular formula C24H19F6NS and a molecular weight of 467.48 g/mol. Its IUPAC name is 2-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-N,N-dimethylaniline.
| Compound Name | 2-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 139073894 |
| Molecular Formula | C24H19F6NS |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]-N,N-dimethylaniline |
| SMILES | Cc1sc(-c2ccccc2)cc1C1=C(c2ccccc2N(C)C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C24H19F6NS/c1-14-17(13-19(32-14)15-9-5-4-6-10-15)21-20(16-11-7-8-12-18(16)31(2)3)22(25,26)24(29,30)23(21,27)28/h4-13H,1-3H3 |
| InChIKey | MDHKBLTYPWGHGN-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|