C16H14N6O2 — CID 139073956
3-pyridin-4-yl-1,2-oxazol-5-amine (PubChem CID 139073956) has the molecular formula C16H14N6O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 3-pyridin-4-yl-1,2-oxazol-5-amine.
| Compound Name | 3-pyridin-4-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 139073956 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 3-pyridin-4-yl-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2ccncc2)no1.Nc1cc(-c2ccncc2)no1 |
| InChI | InChI=1S/2C8H7N3O/c2*9-8-5-7(11-12-8)6-1-3-10-4-2-6/h2*1-5H,9H2 |
| InChIKey | NEQQOUJJVCLOJB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |