About 2-methylquinolin-8-ol
2-methylquinolin-8-ol (PubChem CID 139073966) has the molecular formula C20H18N2O2
and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-methylquinolin-8-ol.
Molecular Properties
| Compound Name | 2-methylquinolin-8-ol |
| PubChem CID | 139073966 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-methylquinolin-8-ol |
| SMILES | Cc1ccc2cccc(O)c2n1.Cc1ccc2cccc(O)c2n1 |
| InChI | InChI=1S/2C10H9NO/c2*1-7-5-6-8-3-2-4-9(12)10(8)11-7/h2*2-6,12H,1H3 |
| InChIKey | GSOMNSBBGPNUNK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylquinolin-8-ol?
The IUPAC name of 2-methylquinolin-8-ol (CID 139073966) is 2-methylquinolin-8-ol.
What is the SMILES notation for 2-methylquinolin-8-ol?
The canonical SMILES for 2-methylquinolin-8-ol is Cc1ccc2cccc(O)c2n1.Cc1ccc2cccc(O)c2n1.
What is the InChIKey of 2-methylquinolin-8-ol?
The InChIKey is GSOMNSBBGPNUNK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H9NO/c2*1-7-5-6-8-3-2-4-9(12)10(8)11-7/h2*2-6,12H,1H3.
What are the key properties of 2-methylquinolin-8-ol?
2-methylquinolin-8-ol has a molecular weight of 318.38 g/mol, XLogP of 4.50, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylquinolin-8-ol is sourced from PubChem (CID 139073966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).