About 4-bromo-2,6-dimethylaniline
4-bromo-2,6-dimethylaniline (PubChem CID 139074029) has the molecular formula C16H20Br2N2
and a molecular weight of 400.16 g/mol. Its IUPAC name is 4-bromo-2,6-dimethylaniline.
Molecular Properties
| Compound Name | 4-bromo-2,6-dimethylaniline |
| PubChem CID | 139074029 |
| Molecular Formula | C16H20Br2N2 |
| Molecular Weight | 400.16 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 4-bromo-2,6-dimethylaniline |
| SMILES | Cc1cc(Br)cc(C)c1N.Cc1cc(Br)cc(C)c1N |
| InChI | InChI=1S/2C8H10BrN/c2*1-5-3-7(9)4-6(2)8(5)10/h2*3-4H,10H2,1-2H3 |
| InChIKey | DSOPWXCTZDRCOE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.16 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-dimethylaniline?
The IUPAC name of 4-bromo-2,6-dimethylaniline (CID 139074029) is 4-bromo-2,6-dimethylaniline.
What is the SMILES notation for 4-bromo-2,6-dimethylaniline?
The canonical SMILES for 4-bromo-2,6-dimethylaniline is Cc1cc(Br)cc(C)c1N.Cc1cc(Br)cc(C)c1N.
What is the InChIKey of 4-bromo-2,6-dimethylaniline?
The InChIKey is DSOPWXCTZDRCOE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H10BrN/c2*1-5-3-7(9)4-6(2)8(5)10/h2*3-4H,10H2,1-2H3.
What are the key properties of 4-bromo-2,6-dimethylaniline?
4-bromo-2,6-dimethylaniline has a molecular weight of 400.16 g/mol, XLogP of 5.30, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-dimethylaniline is sourced from PubChem (CID 139074029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).