C23H17B3F3NO3 — CID 139074060
1-[2,4,6-tris(4-fluorophenyl)-1,3,5-trioxa-4,6-dibora-2-boranuidacyclohex-2-yl]pyridin-1-ium (PubChem CID 139074060) has the molecular formula C23H17B3F3NO3 and a molecular weight of 444.82 g/mol. Its IUPAC name is 1-[2,4,6-tris(4-fluorophenyl)-1,3,5-trioxa-4,6-dibora-2-boranuidacyclohex-2-yl]pyridin-1-ium.
| Compound Name | 1-[2,4,6-tris(4-fluorophenyl)-1,3,5-trioxa-4,6-dibora-2-boranuidacyclohex-2-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 139074060 |
| Molecular Formula | C23H17B3F3NO3 |
| Molecular Weight | 444.82 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 1-[2,4,6-tris(4-fluorophenyl)-1,3,5-trioxa-4,6-dibora-2-boranuidacyclohex-2-yl]pyridin-1-ium |
| SMILES | Fc1ccc(B2OB(c3ccc(F)cc3)O[B-](c3ccc(F)cc3)([n+]3ccccc3)O2)cc1 |
| InChI | InChI=1S/C23H17B3F3NO3/c27-21-10-4-18(5-11-21)24-31-25(19-6-12-22(28)13-7-19)33-26(32-24,30-16-2-1-3-17-30)20-8-14-23(29)15-9-20/h1-17H |
| InChIKey | QMDGCVYUWNZPBQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.82 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|