C20H19F6N2P — CID 139074231
1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)imidazol-3-ium hexafluorophosphate (PubChem CID 139074231) has the molecular formula C20H19F6N2P and a molecular weight of 432.35 g/mol. Its IUPAC name is 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)imidazol-3-ium hexafluorophosphate.
| Compound Name | 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)imidazol-3-ium hexafluorophosphate |
|---|---|
| PubChem CID | 139074231 |
| Molecular Formula | C20H19F6N2P |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)imidazol-3-ium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.c1cc2c(cc1C[n+]1ccn(-c3ccc4c(c3)CC4)c1)CC2 |
| InChI | InChI=1S/C20H19N2.F6P/c1-2-16-3-5-18(16)11-15(1)13-21-9-10-22(14-21)20-8-7-17-4-6-19(17)12-20;1-7(2,3,4,5)6/h1-2,7-12,14H,3-6,13H2;/q+1;-1 |
| InChIKey | QBRNJTAYPYIOCQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|