C28H22CoN2O4 — CID 139074357
cobalt(2+);2,9-dimethyl-1,10-phenanthroline;dibenzoate (PubChem CID 139074357) has the molecular formula C28H22CoN2O4 and a molecular weight of 509.43 g/mol. Its IUPAC name is cobalt(2+);2,9-dimethyl-1,10-phenanthroline;dibenzoate.
| Compound Name | cobalt(2+);2,9-dimethyl-1,10-phenanthroline;dibenzoate |
|---|---|
| PubChem CID | 139074357 |
| Molecular Formula | C28H22CoN2O4 |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | cobalt(2+);2,9-dimethyl-1,10-phenanthroline;dibenzoate |
| SMILES | Cc1ccc2ccc3ccc(C)nc3c2n1.O=C([O-])c1ccccc1.O=C([O-])c1ccccc1.[Co+2] |
| InChI | InChI=1S/C14H12N2.2C7H6O2.Co/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;2*8-7(9)6-4-2-1-3-5-6;/h3-8H,1-2H3;2*1-5H,(H,8,9);/q;;;+2/p-2 |
| InChIKey | VXIYPCJPTUKGLF-UHFFFAOYSA-L |
| XLogP | 3.50 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|