C25H18ClN5O — CID 139074491
(4R)-6-amino-1-benzyl-4-(4-chlorophenyl)-3-pyridin-4-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 139074491) has the molecular formula C25H18ClN5O and a molecular weight of 439.91 g/mol. Its IUPAC name is (4R)-6-amino-1-benzyl-4-(4-chlorophenyl)-3-pyridin-4-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | (4R)-6-amino-1-benzyl-4-(4-chlorophenyl)-3-pyridin-4-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 139074491 |
| Molecular Formula | C25H18ClN5O |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | (4R)-6-amino-1-benzyl-4-(4-chlorophenyl)-3-pyridin-4-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(-c3ccncc3)nn2Cc2ccccc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18ClN5O/c26-19-8-6-17(7-9-19)21-20(14-27)24(28)32-25-22(21)23(18-10-12-29-13-11-18)30-31(25)15-16-4-2-1-3-5-16/h1-13,21H,15,28H2/t21-/m0/s1 |
| InChIKey | YFZMJCVFFRNBBZ-NRFANRHFSA-N |
| XLogP | 4.86 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|