C28H22CoN2O6 — CID 139074619
2-carboxyphenolate;cobalt(2+);2,9-dimethyl-1,10-phenanthroline;2-hydroxybenzoate (PubChem CID 139074619) has the molecular formula C28H22CoN2O6 and a molecular weight of 541.43 g/mol. Its IUPAC name is 2-carboxyphenolate;cobalt(2+);2,9-dimethyl-1,10-phenanthroline;2-hydroxybenzoate.
| Compound Name | 2-carboxyphenolate;cobalt(2+);2,9-dimethyl-1,10-phenanthroline;2-hydroxybenzoate |
|---|---|
| PubChem CID | 139074619 |
| Molecular Formula | C28H22CoN2O6 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | 2-carboxyphenolate;cobalt(2+);2,9-dimethyl-1,10-phenanthroline;2-hydroxybenzoate |
| SMILES | Cc1ccc2ccc3ccc(C)nc3c2n1.O=C(O)c1ccccc1[O-].O=C([O-])c1ccccc1O.[Co+2] |
| InChI | InChI=1S/C14H12N2.2C7H6O3.Co/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;2*8-6-4-2-1-3-5(6)7(9)10;/h3-8H,1-2H3;2*1-4,8H,(H,9,10);/q;;;+2/p-2 |
| InChIKey | KZYFINHLEVQFRB-UHFFFAOYSA-L |
| XLogP | 3.61 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|