About [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride
[(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride (PubChem CID 139074651) has the molecular formula C12H17ClFNO
and a molecular weight of 245.72 g/mol. Its IUPAC name is [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride.
Molecular Properties
| Compound Name | [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride |
| PubChem CID | 139074651 |
| Molecular Formula | C12H17ClFNO |
| Molecular Weight | 245.72 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride |
| SMILES | OC[C@@H]1C[NH2+]CC[C@H]1c1ccc(F)cc1.[Cl-] |
| InChI | InChI=1S/C12H16FNO.ClH/c13-11-3-1-9(2-4-11)12-5-6-14-7-10(12)8-15;/h1-4,10,12,14-15H,5-8H2;1H/t10-,12-;/m0./s1 |
| InChIKey | KIGXYHWSOJVZNA-JGAZGGJJSA-N |
| XLogP | -2.51 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.72 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride?
The IUPAC name of [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride (CID 139074651) is [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride.
What is the SMILES notation for [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride?
The canonical SMILES for [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride is OC[C@@H]1C[NH2+]CC[C@H]1c1ccc(F)cc1.[Cl-].
What is the InChIKey of [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride?
The InChIKey is KIGXYHWSOJVZNA-JGAZGGJJSA-N. The full InChI is InChI=1S/C12H16FNO.ClH/c13-11-3-1-9(2-4-11)12-5-6-14-7-10(12)8-15;/h1-4,10,12,14-15H,5-8H2;1H/t10-,12-;/m0./s1.
What are the key properties of [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride?
[(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride has a molecular weight of 245.72 g/mol, XLogP of -2.51, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-(4-fluorophenyl)piperidin-1-ium-3-yl]methanol chloride is sourced from PubChem (CID 139074651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).