C30H30N4O2 — CID 139074783
2-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-5,6-diphenylpyridazin-3-one (PubChem CID 139074783) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 2-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-5,6-diphenylpyridazin-3-one.
| Compound Name | 2-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-5,6-diphenylpyridazin-3-one |
|---|---|
| PubChem CID | 139074783 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 2-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-5,6-diphenylpyridazin-3-one |
| SMILES | O=C(CCn1nc(-c2ccccc2)c(-c2ccccc2)cc1=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H30N4O2/c35-28(33-20-18-32(19-21-33)23-24-10-4-1-5-11-24)16-17-34-29(36)22-27(25-12-6-2-7-13-25)30(31-34)26-14-8-3-9-15-26/h1-15,22H,16-21,23H2 |
| InChIKey | RCWHUBFQJGEDLB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |